CAS 933737-29-2

1-(3-Thienylmethyl)-4-piperidinamine

Description:

1-(3-Thienylmethyl)-4-piperidinamine, identified by its CAS number 933737-29-2, is a chemical compound that features a piperidine ring substituted with a thienylmethyl group. The thienyl moiety, derived from thiophene, contributes to the compound's aromatic characteristics and potential biological activity. This compound is typically characterized by its amine functional group, which can participate in hydrogen bonding, influencing its solubility and reactivity. The presence of the piperidine ring suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as piperidine derivatives are often associated with various biological activities. The compound's structure may allow for interactions with biological targets, making it of interest in drug discovery. Additionally, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the environment in which it is studied. Overall, 1-(3-Thienylmethyl)-4-piperidinamine represents a unique scaffold for further exploration in chemical and pharmaceutical research.

Formula: C₁₀H₁₆N₂S

InChI: InChI=1S/C10H16N2S/c11-10-1-4-12(5-2-10)7-9-3-6-13-8-9/h3,6,8,10H,1-2,4-5,7,11H2

InChI key: InChIKey=NTNFMOPKOCZICX-UHFFFAOYSA-N

SMILES: C(N1CCC(N)CC1)C=2C=CSC2

Synonyms:

• 1-(3-Thienylmethyl)-4-piperidinamine
• 4-Piperidinamine, 1-(3-thienylmethyl)-
• 1-(Thiophen-3-ylmethyl)piperidin-4-amine

1-(Thiophen-3-ylmethyl)piperidin-4-amine

CAS: 933737-29-2

Versatile small molecule scaffold

Formula: C₁₀H₁₆N₂S

Purity: Min. 95%

Molecular weight: 196.31 g/mol

Ref: 3D-IMB73729