CymitQuimica logo

CAS 933738-34-2

:

N-[2-(2-ethyl-1-piperidyl)ethyl]propan-2-amine

Description:
N-[2-(2-ethyl-1-piperidyl)ethyl]propan-2-amine, identified by its CAS number 933738-34-2, is a chemical compound that belongs to the class of amines. It features a piperidine ring, which contributes to its potential biological activity, particularly in pharmacological contexts. The structure includes a propan-2-amine moiety, indicating the presence of a secondary amine, which can participate in hydrogen bonding and influence its solubility and reactivity. This compound may exhibit lipophilic characteristics due to the ethyl and piperidine substituents, potentially affecting its permeability across biological membranes. Its specific interactions with biological targets can vary, making it of interest in medicinal chemistry and drug development. The compound's synthesis, stability, and reactivity can be influenced by the presence of functional groups and steric factors inherent in its structure. As with many amines, it may also exhibit basic properties, allowing it to form salts with acids. Overall, N-[2-(2-ethyl-1-piperidyl)ethyl]propan-2-amine is a compound of interest for further research in various chemical and biological applications.
Formula:C12H26N2
InChI:InChI=1/C12H26N2/c1-4-12-7-5-6-9-14(12)10-8-13-11(2)3/h11-13H,4-10H2,1-3H3
SMILES:CCC1CCCCN1CCNC(C)C
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.