CymitQuimica logo

CAS 933738-87-5

:

4-methylpyrimidine-2-carboxylic acid

Description:
4-Methylpyrimidine-2-carboxylic acid, identified by its CAS number 933738-87-5, is a heterocyclic organic compound featuring a pyrimidine ring substituted with a methyl group and a carboxylic acid functional group. This compound typically exhibits characteristics common to pyrimidine derivatives, including moderate solubility in polar solvents due to the presence of the carboxylic acid group, which can engage in hydrogen bonding. The methyl group contributes to its hydrophobic character, influencing its overall solubility and reactivity. As a carboxylic acid, it can participate in acid-base reactions, potentially acting as a weak acid. The compound may also exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its structural features suggest potential applications in the synthesis of more complex molecules or as a building block in organic synthesis. Additionally, the presence of the pyrimidine ring may impart specific electronic properties, affecting its reactivity and interactions with other chemical species.
Formula:C6H6N2O2
InChI:InChI=1/C6H6N2O2/c1-4-2-3-7-5(8-4)6(9)10/h2-3H,1H3,(H,9,10)
InChI key:WBSSDROYPVWGTA-UHFFFAOYSA-N
SMILES:Cc1ccnc(C(=O)O)n1
Synonyms:
  • 2-Pyrimidinecarboxylic Acid, 4-Methyl-
  • 4-Methylpyrimidine-2-carboxylic acid
Found 4 products.