CymitQuimica logo

CAS 933739-55-0

:

5-Bromo-2-chloro-4-pyrimidinecarboxylic acid

Description:
5-Bromo-2-chloro-4-pyrimidinecarboxylic acid is a heterocyclic organic compound characterized by its pyrimidine ring structure, which contains both bromine and chlorine substituents. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of halogens, specifically bromine and chlorine, can influence its reactivity and potential applications in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The molecular structure allows for potential interactions with biological systems, making it of interest in pharmaceutical chemistry. Additionally, the compound may exhibit specific solubility characteristics in polar and non-polar solvents, which can affect its behavior in different environments. Its CAS number, 933739-55-0, serves as a unique identifier for regulatory and safety information. Overall, 5-Bromo-2-chloro-4-pyrimidinecarboxylic acid is a versatile compound with potential applications in medicinal chemistry and agrochemicals, owing to its unique structural features and reactivity.
Formula:C5H2BrClN2O2
InChI:InChI=1S/C5H2BrClN2O2/c6-2-1-8-5(7)9-3(2)4(10)11/h1H,(H,10,11)
InChI key:InChIKey=ASACTXZHBMRYEX-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(Br)=CN=C(Cl)N1
Synonyms:
  • 5-Bromo-2-chloro-4-pyrimidinecarboxylic acid
  • 4-Pyrimidinecarboxylic acid, 5-bromo-2-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.