CAS 933740-79-5

4-amino-6-chloro-quinoline-3-carboxylic acid

Description:

4-Amino-6-chloro-quinoline-3-carboxylic acid is a chemical compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH), contributing to its potential as a biologically active molecule. The presence of a chlorine atom at the 6-position of the quinoline ring enhances its reactivity and may influence its pharmacological properties. This compound is typically used in research and development, particularly in medicinal chemistry, due to its potential applications in drug design and synthesis. Its solubility and stability can vary depending on the pH of the environment, which is important for its biological activity. Additionally, the compound may exhibit various interactions with biological targets, making it of interest for further studies in areas such as antimicrobial or anticancer research. As with many chemical substances, safety and handling precautions should be observed when working with this compound in laboratory settings.

Formula: C₁₀H₇ClN₂O₂

InChI: InChI=1/C10H7ClN2O2/c11-5-1-2-8-6(3-5)9(12)7(4-13-8)10(14)15/h1-4H,(H2,12,13)(H,14,15)

SMILES: c1cc2c(cc1Cl)c(=N)c(c[nH]2)C(=O)O

Synonyms:

• 3-Quinolinecarboxylic acid, 4-amino-6-chloro-
• 4-Amino-6-chloroquinoline-3-carboxylic acid

4-Amino-6-chloroquinoline-3-carboxylic acid

CAS: 933740-79-5

Formula: C₁₀H₇ClN₂O₂

Purity: 95.0%

Molecular weight: 222.63

Ref: 10-F042853