CymitQuimica logo

CAS 933744-97-9

:

1,2-Benzisoxazole-5-ethanamine

Description:
1,2-Benzisoxazole-5-ethanamine is a chemical compound characterized by its unique bicyclic structure, which consists of a benzene ring fused to an isoxazole ring. This compound features an ethylamine side chain at the 5-position of the isoxazole, contributing to its potential biological activity. It is typically a white to off-white solid and is soluble in polar organic solvents. The presence of both aromatic and heterocyclic components in its structure may impart interesting electronic properties, making it a subject of interest in medicinal chemistry. The compound may exhibit various pharmacological activities, including potential roles in neuropharmacology or as a building block for the synthesis of more complex molecules. Its CAS number, 933744-97-9, allows for precise identification in chemical databases and literature. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C9H10N2O
InChI:InChI=1S/C9H10N2O/c10-4-3-7-1-2-9-8(5-7)6-11-12-9/h1-2,5-6H,3-4,10H2
InChI key:InChIKey=GZWHVFBHRXVUNF-UHFFFAOYSA-N
SMILES:C(CN)C=1C=C2C(=CC1)ON=C2
Synonyms:
  • 1,2-Benzisoxazole-5-ethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.