CymitQuimica logo

CAS 933745-06-3

:

6-Methyl-2-(3-piperidinyl)-1H-benzimidazole

Description:
6-Methyl-2-(3-piperidinyl)-1H-benzimidazole is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with a methyl group and a piperidine moiety. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the piperidine ring, which is known for its role in various pharmacological applications. The benzimidazole framework is often associated with diverse therapeutic effects, including anti-parasitic and anti-cancer properties. In terms of physical properties, compounds of this nature may be solid at room temperature, with solubility varying based on the presence of functional groups and the overall polarity of the molecule. The compound's molecular interactions, stability, and reactivity can be influenced by its substituents, making it a subject of interest in medicinal chemistry and drug development. As with any chemical substance, safety data and handling precautions should be considered, particularly in laboratory settings.
Formula:C13H17N3
InChI:InChI=1S/C13H17N3/c1-9-4-5-11-12(7-9)16-13(15-11)10-3-2-6-14-8-10/h4-5,7,10,14H,2-3,6,8H2,1H3,(H,15,16)
InChI key:InChIKey=AGJOSQVIIMRBCK-UHFFFAOYSA-N
SMILES:CC=1C=C2N=C(NC2=CC1)C3CCCNC3
Synonyms:
  • 1H-Benzimidazole, 6-methyl-2-(3-piperidinyl)-
  • 6-Methyl-2-(3-piperidinyl)-1H-benzimidazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.