CAS 933747-26-3
:quinazoline-4-carbaldehyde
Description:
Quinazoline-4-carbaldehyde is an organic compound characterized by its quinazoline core structure, which consists of a fused benzene and pyrimidine ring. This compound features an aldehyde functional group (-CHO) at the 4-position of the quinazoline ring, contributing to its reactivity and potential applications in organic synthesis. Quinazoline derivatives are known for their biological activity, including antimicrobial and anticancer properties, making quinazoline-4-carbaldehyde of interest in medicinal chemistry. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its reactivity is influenced by the presence of the aldehyde group, which can participate in various chemical reactions, such as condensation and oxidation. Additionally, quinazoline-4-carbaldehyde can serve as a building block for the synthesis of more complex molecules, further expanding its utility in research and pharmaceutical development. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C9H6N2O
InChI:InChI=1/C9H6N2O/c12-5-9-7-3-1-2-4-8(7)10-6-11-9/h1-6H
SMILES:c1ccc2c(c1)c(C=O)ncn2
Synonyms:- 4-Quinazolinecarboxaldehyde
- Quinazoline-4-carbaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
