CAS 933753-13-0

2-(Aminomethyl)-4-thiazoleacetic acid

Description:

2-(Aminomethyl)-4-thiazoleacetic acid, identified by its CAS number 933753-13-0, is an organic compound characterized by the presence of both an amino group and a thiazole ring, which contributes to its unique chemical properties. This compound typically exhibits a solid state at room temperature and is soluble in polar solvents due to its carboxylic acid functional group. The thiazole moiety imparts heterocyclic characteristics, influencing its reactivity and potential biological activity. It may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it of interest in medicinal chemistry and drug development. The presence of the amino group suggests potential for interactions with biological targets, which could lead to applications in pharmaceuticals. Additionally, the compound's structural features may allow it to act as a ligand in coordination chemistry. Overall, 2-(Aminomethyl)-4-thiazoleacetic acid is a versatile compound with potential applications in various fields, including biochemistry and materials science.

Formula: C₆H₈N₂O₂S

InChI: InChI=1S/C6H8N2O2S/c7-2-5-8-4(3-11-5)1-6(9)10/h3H,1-2,7H2,(H,9,10)

InChI key: InChIKey=GCPVEQHUCJDANR-UHFFFAOYSA-N

SMILES: C(C(O)=O)C=1N=C(CN)SC1

Synonyms:

• 2-(Aminomethyl)-4-thiazoleacetic acid
• 4-Thiazoleacetic acid, 2-(aminomethyl)-