
CAS 933755-66-9
:3-(1,3,4-Thiadiazol-2-yl)piperidine
Description:
3-(1,3,4-Thiadiazol-2-yl)piperidine is a chemical compound characterized by the presence of a piperidine ring substituted with a 1,3,4-thiadiazole moiety. The piperidine ring is a six-membered saturated heterocycle containing one nitrogen atom, while the thiadiazole is a five-membered ring containing two nitrogen atoms and one sulfur atom. This compound typically exhibits properties such as moderate solubility in polar solvents and potential biological activity, making it of interest in medicinal chemistry. The thiadiazole group is known for its role in various pharmacological activities, including antimicrobial and anti-inflammatory effects. The presence of the piperidine ring can enhance the compound's ability to interact with biological targets, potentially influencing its pharmacokinetics and pharmacodynamics. Overall, 3-(1,3,4-Thiadiazol-2-yl)piperidine represents a class of compounds that may serve as valuable scaffolds in drug discovery and development, particularly in the search for new therapeutic agents.
Formula:C7H11N3S
InChI:InChI=1S/C7H11N3S/c1-2-6(4-8-3-1)7-10-9-5-11-7/h5-6,8H,1-4H2
InChI key:InChIKey=VNFFFJFYZUHKMG-UHFFFAOYSA-N
SMILES:C1(=NN=CS1)C2CCCNC2
Synonyms:- Piperidine, 3-(1,3,4-thiadiazol-2-yl)-
- 3-(1,3,4-Thiadiazol-2-yl)piperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.