CAS 933756-68-4

1,2,3,4-Tetrahydro-3-quinolineacetic acid

Description:

1,2,3,4-Tetrahydro-3-quinolineacetic acid is a chemical compound characterized by its bicyclic structure, which includes a quinoline moiety fused with a saturated tetrahydro framework. This compound features a carboxylic acid functional group, contributing to its acidic properties. It is typically a white to off-white solid and is soluble in polar solvents, which may include water and alcohols, depending on the specific conditions. The presence of the quinoline ring suggests potential biological activity, as quinoline derivatives are often explored for their pharmacological properties, including antimicrobial and anti-inflammatory effects. The compound's molecular structure allows for various interactions, making it of interest in medicinal chemistry and drug development. Additionally, its CAS number, 933756-68-4, serves as a unique identifier for regulatory and research purposes. Overall, 1,2,3,4-Tetrahydro-3-quinolineacetic acid represents a significant compound for further exploration in both synthetic and medicinal chemistry contexts.

Formula: C₁₁H₁₃NO₂

InChI: InChI=1S/C11H13NO2/c13-11(14)6-8-5-9-3-1-2-4-10(9)12-7-8/h1-4,8,12H,5-7H2,(H,13,14)

InChI key: InChIKey=CIHMGVKHCUOVAG-UHFFFAOYSA-N

SMILES: C(C(O)=O)C1CC=2C(NC1)=CC=CC2

Synonyms:

• 1,2,3,4-Tetrahydro-3-quinolineacetic acid
• 3-Quinolineacetic acid, 1,2,3,4-tetrahydro-

3-Quinolineacetic acid, 1,2,3,4-tetrahydro-

CAS: 933756-68-4

Formula: C₁₁H₁₃NO₂

Purity: 98%

Molecular weight: 191.2264

Ref: IN-DA01Q5PA

2-(1,2,3,4-Tetrahydroquinolin-3-yl)acetic acid

CAS: 933756-68-4

2-(1,2,3,4-Tetrahydroquinolin-3-yl)acetic acid

Purity: 98%

Ref: 54-OR1040724