CymitQuimica logo

CAS 933758-73-7

:

3-[(Tetrahydro-2H-pyran-4-yl)methoxy]piperidine

Description:
3-[(Tetrahydro-2H-pyran-4-yl)methoxy]piperidine is a chemical compound characterized by its unique structure, which includes a piperidine ring and a tetrahydro-2H-pyran moiety. The piperidine ring contributes to its basicity and potential for forming hydrogen bonds, while the tetrahydro-2H-pyran group adds to its hydrophobic character and may influence its solubility in organic solvents. This compound is typically used in medicinal chemistry and drug development due to its potential biological activity. Its molecular structure suggests that it may interact with various biological targets, making it of interest in pharmacological studies. The presence of the methoxy group enhances its reactivity and solubility properties. Additionally, the compound's stereochemistry can significantly affect its biological activity, making it essential to consider when evaluating its pharmacokinetic and pharmacodynamic profiles. Overall, 3-[(Tetrahydro-2H-pyran-4-yl)methoxy]piperidine is a versatile compound with potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C11H21NO2
InChI:InChI=1S/C11H21NO2/c1-2-11(8-12-5-1)14-9-10-3-6-13-7-4-10/h10-12H,1-9H2
InChI key:InChIKey=VXHMGFPKVLKFMB-UHFFFAOYSA-N
SMILES:C(OC1CCCNC1)C2CCOCC2
Synonyms:
  • Piperidine, 3-[(tetrahydro-2H-pyran-4-yl)methoxy]-
  • 3-[(Tetrahydro-2H-pyran-4-yl)methoxy]piperidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.