CAS 93376-04-6
:(3R,4R)-3,4-bis(3-hydroxy-4-methoxybenzyl)dihydrofuran-2(3H)-one
Description:
The chemical substance known as (3R,4R)-3,4-bis(3-hydroxy-4-methoxybenzyl)dihydrofuran-2(3H)-one, with the CAS number 93376-04-6, is a complex organic compound characterized by its unique structural features. It contains a dihydrofuran ring, which contributes to its cyclic nature, and is substituted with two 3-hydroxy-4-methoxybenzyl groups, enhancing its potential for biological activity. The presence of hydroxyl and methoxy functional groups suggests that this compound may exhibit polar characteristics, influencing its solubility and reactivity. The stereochemistry indicated by the (3R,4R) configuration implies specific spatial arrangements of atoms, which can significantly affect the compound's interactions with biological targets. Such compounds are often studied for their potential pharmacological properties, including antioxidant or anti-inflammatory activities. Overall, the structural complexity and functional group diversity of this substance make it a subject of interest in medicinal chemistry and natural product research.
Formula:C20H22O6
InChI:InChI=1/C20H22O6/c1-24-18-5-3-12(9-16(18)21)7-14-11-26-20(23)15(14)8-13-4-6-19(25-2)17(22)10-13/h3-6,9-10,14-15,21-22H,7-8,11H2,1-2H3/t14-,15+/m0/s1
Synonyms:- 2(3H)-Furanone, dihydro-3,4-bis((3-hydroxy-4-methoxyphenyl)methyl)-, (3R-trans)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Prestegane B - Hewittia subloblata
CAS:<p>Prestegane B is a bioactive compound, which is a natural product extracted from the plant Hewittia sublobata. This compound is sourced from the leaves and stems of the plant, which have been traditionally used in various folk medicines. The extraction process involves detailed phytochemical analysis to isolate the active constituents.</p>Formula:C20H22O6Purity:Min. 95%Molecular weight:358.39 g/mol
