CAS 933761-00-3
:2-morpholino-2-(3-pyridyl)acetic acid
Description:
2-Morpholino-2-(3-pyridyl)acetic acid is a chemical compound characterized by its unique structure, which includes a morpholine ring and a pyridine moiety. This compound typically exhibits properties such as being a white to off-white solid, with moderate solubility in polar solvents like water and methanol, owing to the presence of both acidic and basic functional groups. The morpholine ring contributes to its potential as a pharmacophore, while the pyridine ring may enhance its biological activity. The compound is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Its molecular structure allows for interactions with biological targets, making it a subject of interest in drug design and synthesis. Additionally, the presence of the carboxylic acid group suggests it may participate in acid-base reactions and form salts, which can influence its pharmacokinetic properties. Overall, 2-morpholino-2-(3-pyridyl)acetic acid is a versatile compound with potential implications in therapeutic applications.
Formula:C11H14N2O3
InChI:InChI=1/C11H14N2O3/c14-11(15)10(9-2-1-3-12-8-9)13-4-6-16-7-5-13/h1-3,8,10H,4-7H2,(H,14,15)
SMILES:c1cc(cnc1)C(C(=O)O)N1CCOCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
