CAS 93379-48-7
:(-)-4,5-Bis[hydroxy(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolane
Description:
The chemical substance known as (-)-4,5-Bis[hydroxy(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolane, with the CAS number 93379-48-7, is characterized by its complex molecular structure that includes a dioxolane ring, which is a five-membered cyclic ether containing two oxygen atoms. This compound features two hydroxy groups attached to diphenylmethyl substituents, contributing to its potential as a chiral auxiliary in asymmetric synthesis. The presence of the dimethyl groups enhances its steric properties, influencing its reactivity and interaction with other molecules. The stereochemistry of the compound is significant, as the (-) designation indicates its specific optical activity, which is crucial in applications where chirality plays a vital role, such as in pharmaceuticals. Its solubility and stability in various solvents can vary, making it important to consider these factors in practical applications. Overall, this compound's unique structural features and chirality make it a valuable substance in organic synthesis and medicinal chemistry.
Formula:C31H30O4
InChI:InChI=1/C31H30O4/c1-29(2)34-27(30(32,23-15-7-3-8-16-23)24-17-9-4-10-18-24)28(35-29)31(33,25-19-11-5-12-20-25)26-21-13-6-14-22-26/h3-22,27-28,32-33H,1-2H3/t27-,28-/m1/s1
SMILES:CC1(C)O[C@H]([C@H](C(c2ccccc2)(c2ccccc2)O)O1)C(c1ccccc1)(c1ccccc1)O
Synonyms:- (4R,5R)-2,2-Dimethyl-α,α,α',α'-tetraphenyldioxolane-4,5-dimethanol
- (-)-Taddol
- (2,2-Dimethyl-1,3-Dioxolane-4,5-Diyl)Bis(Diphenylmethanol)
- [(4R,5R)-2,2-dimethyl-1,3-dioxolane-4,5-diyl]bis(diphenylmethanol)
- (4R,5R)-(-)-2,2-Dimethyl-α,α,α',α'-tetraphenyl-1,3-dioxolane-4,5-dimethanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
(-)-4,5-Bis[hydroxy(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolane
CAS:Formula:C31H30O4Purity:>97.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:466.58(4R,5R)-(-)-2,2-Dimethyl-α,α,α',α'-tetraphenyl-1,3-dioxolane-4,5-dimethanol (R,R)-TADDOL
CAS:(4R,5R)-(-)-2,2-Dimethyl-α,α,α',α'-tetraphenyl-1,3-dioxolane-4,5-dimethanol (R,R)-TADDOL
Formula:C31H30O4Color and Shape:white pwdr.Molecular weight:466.57((4R,5R)-2,2-Dimethyl-1,3-dioxolane-4,5-diyl)bis(diphenylmethanol)
CAS:Formula:C31H30O4Purity:96%Color and Shape:SolidMolecular weight:466.5675(4R,5R)-2,2-Dimethyl-α,α,α',α'-tetraphenyldioxolane-4,5-dimethanol
CAS:(4R,5R)-2,2-Dimethyl-α,α,α',α'-tetraphenyldioxolane-4,5-dimethanolFormula:C31H30O4Purity:98%,99%eeColor and Shape: off-white solidMolecular weight:466.57g/mol2,3-O-Isopropylidene-1,1,4,4-tetraphenyl-L-threitol
CAS:Formula:C31H30O4Purity:≥ 96.5%Color and Shape:White to off-white crystalline powderMolecular weight:466.58(4R,5R)-2,2-Dimethyl-α,α,α’,α’-tetraphenyldioxolane-4,5-dimethanol
CAS:Formula:C31H30O4Purity:96%Color and Shape:Liquid, No data available.Molecular weight:466.5772,3-O-Isopropylidene-1,1,4,4-tetraphenyl-L-threitol
CAS:2,3-O-Isopropylidene-1,1,4,4-tetraphenyl-L-threitol is an organic compound that has been synthesized in a reaction mechanism that involves a β-amino acid and enantiomerically pure (S)-succinic anhydride. The molecular weight of this compound is 266.2 g/mol. It has a stable complex with the hydrogen bond between two molecules in a p2 group. This compound can be used as an optical sensor for the detection of β-amino acids and its enantiomers. The asymmetric synthesis of this molecule is steric interactions.Formula:C31H30O4Purity:Min. 95%Color and Shape:White PowderMolecular weight:466.57 g/mol






