CymitQuimica logo

CAS 933791-34-5

:

6-(1-Hydroxy-1-methylethyl)-2-pyridinecarboxaldehyde

Description:
6-(1-Hydroxy-1-methylethyl)-2-pyridinecarboxaldehyde, identified by its CAS number 933791-34-5, is an organic compound featuring a pyridine ring substituted with an aldehyde and a hydroxyalkyl group. This compound typically exhibits characteristics common to aldehydes, such as reactivity towards nucleophiles and the ability to undergo oxidation to form carboxylic acids. The presence of the hydroxy group enhances its solubility in polar solvents and may influence its reactivity and stability. The pyridine moiety contributes to the compound's potential biological activity, as pyridine derivatives are often found in pharmaceuticals and agrochemicals. Additionally, the specific arrangement of functional groups can affect the compound's physical properties, such as boiling point and melting point, as well as its spectral characteristics in techniques like NMR and IR spectroscopy. Overall, this compound's unique structure suggests potential applications in various fields, including medicinal chemistry and organic synthesis.
Formula:C9H11NO2
InChI:InChI=1S/C9H11NO2/c1-9(2,12)8-5-3-4-7(6-11)10-8/h3-6,12H,1-2H3
InChI key:InChIKey=OVYRPDFPIPMCFM-UHFFFAOYSA-N
SMILES:C(C)(C)(O)C=1N=C(C=O)C=CC1
Synonyms:
  • 2-Pyridinecarboxaldehyde, 6-(1-hydroxy-1-methylethyl)-
  • 6-(1-Hydroxy-1-methylethyl)-2-pyridinecarboxaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.