CAS 93381-28-3

R(-)-3-bromo-2-methyl-1-propanol

Description:

R(-)-3-bromo-2-methyl-1-propanol is a chiral organic compound characterized by the presence of a bromine atom and a hydroxyl group attached to a three-carbon chain. Its molecular structure features a bromine substituent at the third carbon and a methyl group at the second carbon, contributing to its stereochemistry. This compound is typically a colorless to pale yellow liquid and is soluble in polar solvents due to the hydroxyl group, which can engage in hydrogen bonding. The presence of the bromine atom makes it a potential electrophile, allowing it to participate in various nucleophilic substitution reactions. R(-)-3-bromo-2-methyl-1-propanol can be utilized in organic synthesis, particularly in the preparation of other chiral compounds or as an intermediate in pharmaceutical applications. Its specific optical activity is determined by its R configuration, which is significant in the context of stereochemistry and its interactions in biological systems. Safety precautions should be observed when handling this compound, as it may pose health risks associated with brominated organic compounds.

Formula: C₄H₉BrO

InChI: InChI=1/C4H9BrO/c1-4(2-5)3-6/h4,6H,2-3H2,1H3/t4-/m0/s1

SMILES: C[C@@H](CBr)CO

Synonyms:

• (2R)-3-bromo-2-methylpropan-1-ol
• (R)-(-)-3-Bromo-2-methyl-1-propanol

(R)-3-Bromo-2-methylpropan-1-ol

CAS: 93381-28-3

Formula: C₄H₉BrO

Purity: 98%

Color and Shape: Liquid

Molecular weight: 153.0177

Ref: IN-DA003C3Z

(R)-3-Bromo-2-methylpropan-1-ol

CAS: 93381-28-3

(R)-3-Bromo-2-methylpropan-1-ol

Purity: 98%

Molecular weight: 153.02g/mol

Ref: 54-OR1068073

(R)-3-Bromo-2-methylpropan-1-ol

CAS: 93381-28-3

Purity: 98%

Molecular weight: 153.0189972

Ref: 10-F621851

(2R)-3-Bromo-2-methyl-propan-1-ol

CAS: 93381-28-3

(2R)-3-Bromo-2-methyl-propan-1-ol is a vicinal diol with a chemical formula of CHCHOH. It has been used in medicinal chemistry as a toolbox molecule due to its ability to target many biological activities. (2R)-3-Bromo-2-methyl-propan-1-ol is an alcohol that has two hydrogens on the same side of the double bond, and one hydrogen on the opposite side. This stereospecificity makes it useful for research in stereochemistry, which is the study of the spatial relationship between atoms in molecules. (2R)-3-Bromo-2-methylpropane can be used as an enantiomer because it has one chiral carbon atom. This means that only one form of this molecule exists, which is determined by the configuration around this single chiral carbon atom. The biological activity of (2R)-3-(bromomet

Formula: C₄H₉BrO

Purity: Min. 95%

Molecular weight: 153.02 g/mol

Ref: 3D-TDA38128