CymitQuimica logo

CAS 93383-53-0

:

4,4,4-trifluoro-2-oxobutyl dihydrogen phosphate

Description:
4,4,4-Trifluoro-2-oxobutyl dihydrogen phosphate is a chemical compound characterized by its unique structure, which includes a phosphate group and a trifluoromethyl substituent. This compound typically exhibits properties associated with both organophosphates and fluorinated compounds, such as increased stability and potential reactivity due to the presence of the phosphate moiety. The trifluoromethyl group can enhance lipophilicity and influence the compound's biological activity, making it of interest in various fields, including agrochemicals and pharmaceuticals. The presence of the dihydrogen phosphate group suggests that it can participate in hydrogen bonding, which may affect its solubility and interaction with biological systems. Additionally, the compound's fluorine atoms can impart unique electronic properties, potentially affecting its reactivity and interaction with other molecules. Overall, 4,4,4-trifluoro-2-oxobutyl dihydrogen phosphate is a versatile compound with applications that may leverage its distinctive chemical characteristics.
Formula:C4H6F3O5P
InChI:InChI=1/C4H6F3O5P/c5-4(6,7)1-3(8)2-12-13(9,10)11/h1-2H2,(H2,9,10,11)
SMILES:C(C(=O)COP(=O)(O)O)C(F)(F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.