CymitQuimica logo

CAS 933986-99-3

:

2-[2-(1-Pyrrolidinyl)ethoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine

Description:
2-[2-(1-Pyrrolidinyl)ethoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, with CAS number 933986-99-3, is a chemical compound characterized by its complex structure, which includes a pyridine ring, a pyrrolidine moiety, and a boron-containing dioxaborolane group. This compound typically exhibits properties such as moderate solubility in organic solvents, which is common for compounds containing both nitrogen and boron functionalities. The presence of the pyrrolidine group may impart certain biological activities, potentially making it of interest in medicinal chemistry. The dioxaborolane unit is often associated with applications in organic synthesis and materials science, particularly in the context of boron chemistry. Additionally, the compound may exhibit specific reactivity patterns due to the presence of the boron atom, which can participate in various chemical reactions, including those involving nucleophiles. Overall, this compound's unique structural features suggest potential utility in various chemical and pharmaceutical applications, although specific reactivity and biological activity would require further investigation.
Formula:C17H27BN2O3
InChI:InChI=1S/C17H27BN2O3/c1-16(2)17(3,4)23-18(22-16)14-7-8-15(19-13-14)21-12-11-20-9-5-6-10-20/h7-8,13H,5-6,9-12H2,1-4H3
InChI key:InChIKey=VBHGEDHPJCUYEX-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=CC(OCCN3CCCC3)=NC2
Synonyms:
  • 2-[2-(Pyrrolidin-1-yl)ethoxy]-5-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)pyridine
  • 2-[2-(1-Pyrrolidinyl)ethoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
  • Pyridine, 2-[2-(1-pyrrolidinyl)ethoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.