CAS 933988-34-2

N2,N2,N5-Trimethyl-2,5-pyridinediamine

Description:

N2,N2,N5-Trimethyl-2,5-pyridinediamine, identified by its CAS number 933988-34-2, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing nitrogen atoms. This compound features three methyl groups attached to the nitrogen atoms at the 2 and 5 positions of the pyridine ring, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The presence of multiple amine groups suggests that it may exhibit basic properties and can participate in hydrogen bonding, making it potentially useful in various chemical reactions, including as a ligand in coordination chemistry. Additionally, its structure may impart specific reactivity patterns, making it of interest in synthetic organic chemistry and materials science. Safety data should be consulted, as with any chemical, to understand its handling, storage, and potential hazards.

Formula: C₈H₁₃N₃

InChI: InChI=1S/C8H13N3/c1-9-7-4-5-8(10-6-7)11(2)3/h4-6,9H,1-3H3

InChI key: InChIKey=PZIKBYIERKNRFH-UHFFFAOYSA-N

SMILES: N(C)(C)C1=CC=C(NC)C=N1

Synonyms:

• 2,5-Pyridinediamine N2,N2,N5-trimethyl-
• N-(6-Dimethylaminopyridin-3-yl)-N-methylamine
• 2-N,2-N,5-N-Trimethylpyridine-2,5-diamine
• N2,N2,N5-Trimethyl-2,5-pyridinediamine
• 2,5-Pyridinediamine, N2,N2,N5-trimethyl-