CymitQuimica logo

CAS 933988-75-1

:

2-(2,5-Difluorophenyl)-5-pyrimidinecarboxylic acid

Description:
2-(2,5-Difluorophenyl)-5-pyrimidinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a pyrimidine ring and a difluorophenyl group. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the carboxylic acid functional group, which can engage in hydrogen bonding. The difluorophenyl moiety may influence its electronic properties, potentially enhancing its reactivity or interaction with biological targets. The presence of fluorine atoms often contributes to increased lipophilicity and metabolic stability. This compound may be of interest in pharmaceutical research, particularly in the development of novel therapeutic agents, due to its potential biological activity. Additionally, its molecular structure suggests that it could participate in various chemical reactions, including esterification and amidation, making it versatile for synthetic applications. Overall, 2-(2,5-Difluorophenyl)-5-pyrimidinecarboxylic acid represents a valuable compound in both organic synthesis and medicinal chemistry.
Formula:C11H6F2N2O2
InChI:InChI=1S/C11H6F2N2O2/c12-7-1-2-9(13)8(3-7)10-14-4-6(5-15-10)11(16)17/h1-5H,(H,16,17)
InChI key:InChIKey=DBPZPSJZEOLWJP-UHFFFAOYSA-N
SMILES:FC1=C(C=C(F)C=C1)C=2N=CC(C(O)=O)=CN2
Synonyms:
  • 2-(2,5-Difluorophenyl)-5-pyrimidinecarboxylic acid
  • 2-(2,5-Difluorophenyl)pyrimidine-5-carboxylic acid
  • 5-Pyrimidinecarboxylic acid, 2-(2,5-difluorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.