
CAS 933989-50-5
:Benzenemethanamine, 4-(4-morpholinylsulfonyl)-, hydrochloride (1:1)
Description:
Benzenemethanamine, 4-(4-morpholinylsulfonyl)-, hydrochloride (1:1), commonly referred to as a sulfonamide derivative, is a chemical compound characterized by its amine and sulfonyl functional groups. This substance typically appears as a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and bioavailability. The morpholine ring contributes to its pharmacological properties, often making it a subject of interest in medicinal chemistry for potential therapeutic applications. The compound's structure suggests it may exhibit properties such as moderate to high polarity, which can influence its interaction with biological systems. Additionally, the presence of the sulfonyl group may impart unique reactivity and stability characteristics. As with many amine-containing compounds, it is essential to handle this substance with care, considering potential toxicity and reactivity, particularly in the context of drug development and synthesis. Always refer to safety data sheets and relevant literature for specific handling and safety guidelines.
Formula:C11H16N2O3S·ClH
InChI:InChI=1S/C11H16N2O3S.ClH/c12-9-10-1-3-11(4-2-10)17(14,15)13-5-7-16-8-6-13;/h1-4H,5-9,12H2;1H
InChI key:InChIKey=VDVLIALYFAWJCR-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C1=CC=C(CN)C=C1)N2CCOCC2.Cl
Synonyms:- Benzenemethanamine, 4-(4-morpholinylsulfonyl)-, hydrochloride (1:1)
- [4-[(Morpholin-4-yl)sulfonyl]benzyl]amine hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-(Morpholine-4-sulfonyl)-benzylamine Hydrochloride
CAS:Controlled ProductFormula:C11H17ClN2O3SColor and Shape:NeatMolecular weight:292.782
