CymitQuimica logo

CAS 933994-02-6

:

(1E)-3,3,4,4,4-Pentafluoro-1-nitro-1-butene

Description:
(1E)-3,3,4,4,4-Pentafluoro-1-nitro-1-butene is a fluorinated organic compound characterized by its unique structure, which includes a butene backbone with multiple fluorine substituents and a nitro group. The presence of five fluorine atoms significantly influences its physical and chemical properties, making it highly polar and potentially reactive. This compound is likely to exhibit low volatility and high stability under standard conditions, although the nitro group may introduce some degree of reactivity, particularly in the presence of reducing agents. Its fluorinated nature suggests that it may have applications in specialized fields such as materials science, pharmaceuticals, or as a potential intermediate in organic synthesis. Additionally, the compound's environmental persistence and potential toxicity should be considered, as fluorinated compounds often exhibit bioaccumulation tendencies. Overall, (1E)-3,3,4,4,4-Pentafluoro-1-nitro-1-butene represents a complex and interesting molecule within the realm of fluorinated organic chemistry.
Formula:C4H2F5NO2
InChI:InChI=1S/C4H2F5NO2/c5-3(6,4(7,8)9)1-2-10(11)12/h1-2H/b2-1+
InChI key:InChIKey=JLFNUYOHWUNVMI-OWOJBTEDSA-N
SMILES:C(C(F)(F)F)(/C=C/N(=O)=O)(F)F
Synonyms:
  • 1-Butene, 3,3,4,4,4-pentafluoro-1-nitro-, (1E)-
  • (1E)-3,3,4,4,4-Pentafluoro-1-nitro-1-butene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.