CAS 934-07-6
:Methyl 5-bromo-1H-pyrrole-2-carboxylate
Description:
Methyl 5-bromo-1H-pyrrole-2-carboxylate is a chemical compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. The presence of a bromine atom at the 5-position of the pyrrole ring contributes to its reactivity and potential applications in organic synthesis. The carboxylate functional group, specifically the methyl ester at the 2-position, enhances its solubility in organic solvents and makes it a versatile intermediate in various chemical reactions. This compound is typically used in the synthesis of more complex molecules, including pharmaceuticals and agrochemicals. Its properties include moderate stability under standard conditions, but it may be sensitive to strong bases or nucleophiles due to the electrophilic nature of the carbonyl carbon in the ester group. Additionally, Methyl 5-bromo-1H-pyrrole-2-carboxylate can undergo various transformations, such as nucleophilic substitution and coupling reactions, making it valuable in synthetic organic chemistry. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C6H6BrNO2
InChI:InChI=1/C6H6BrNO2/c1-10-6(9)4-2-3-5(7)8-4/h2-3,8H,1H3
SMILES:COC(=O)c1ccc(Br)[nH]1
Synonyms:- 1H-pyrrole-2-carboxylic acid, 5-bromo-, methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1H-Pyrrole-2-carboxylic acid, 5-bromo-, methyl ester
CAS:Formula:C6H6BrNO2Purity:95%Color and Shape:SolidMolecular weight:204.0213Methyl 5-bromo-1H-pyrrole-2-carboxylate
CAS:Methyl 5-bromo-1H-pyrrole-2-carboxylatePurity:96%Molecular weight:204.02g/molmethyl 5-bromo-1H-pyrrole-2-carboxylate
CAS:methyl 5-bromo-1H-pyrrole-2-carboxylatePurity:≥98%Molecular weight:204.02g/molmethyl 5-bromo-1H-pyrrole-2-carboxylate
CAS:methyl 5-bromo-1H-pyrrole-2-carboxylate is a marine derived natural products found in Lissodendoryx sp.Formula:C6H6BrNO2Purity:98.03%Color and Shape:SolidMolecular weight:204.02Methyl 5-bromo-1H-pyrrole-2-carboxylate
CAS:Formula:C6H6BrNO2Purity:95%Color and Shape:SolidMolecular weight:204.023Methyl 5-Bromo-1H-pyrrole-2-carboxylate
CAS:Controlled ProductApplications Methyl 5-Bromo-1H-pyrrole-2-carboxylate is a chemical reagent used in pharmaceutical synthesis.
References Wang, M. et al.: Org. Biomol. Chem., 11, 2574 (2013); Xiang, H. et al.: RSC Adv., 3, 5807 (2013);Formula:C6H6BrNO2Color and Shape:NeatMolecular weight:204.021




