CymitQuimica logo

CAS 934-67-8

:

cis-4-Methylcyclohexanecarboxylic acid

Description:
Cis-4-Methylcyclohexanecarboxylic acid is a cyclic carboxylic acid characterized by its unique molecular structure, which includes a cyclohexane ring with a methyl group and a carboxylic acid functional group. The "cis" designation indicates that the methyl group and the carboxylic acid group are on the same side of the cyclohexane ring, influencing its spatial configuration and reactivity. This compound typically exhibits properties such as being a colorless to pale yellow liquid or solid, depending on temperature and purity. It is soluble in organic solvents and has limited solubility in water due to its hydrophobic cyclohexane structure. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, including esterification and decarboxylation. Additionally, cis-4-Methylcyclohexanecarboxylic acid can be utilized in organic synthesis and may serve as an intermediate in the production of pharmaceuticals and agrochemicals. Its specific applications and behavior can vary based on the context of use and the presence of other functional groups in a reaction.
Formula:C8H14O2
InChI:InChI=1/C8H14O2/c1-6-2-4-7(5-3-6)8(9)10/h6-7H,2-5H2,1H3,(H,9,10)/t6-,7+
InChI key:InChIKey=QTDXSEZXAPHVBI-KNVOCYPGNA-N
SMILES:C(O)(=O)[C@H]1CC[C@@H](C)CC1
Synonyms:
  • Cyclohexanecarboxylic acid, 4-methyl-, cis-
  • cis-4-Methylcyclohexanecarboxylic acid
Found 3 products.