
CAS 934012-90-5
:4-Fluoro-2-(methoxymethyl)benzonitrile
Description:
4-Fluoro-2-(methoxymethyl)benzonitrile is an organic compound characterized by its aromatic structure, which includes a fluorine atom and a methoxymethyl group attached to a benzonitrile framework. The presence of the fluorine atom typically enhances the compound's lipophilicity and may influence its reactivity and biological activity. The methoxymethyl group contributes to the compound's overall polarity and can affect its solubility in various solvents. As a nitrile, the compound features a cyano group (-C≡N), which is known for its ability to participate in nucleophilic reactions and can serve as a functional group in synthetic chemistry. This compound may be of interest in pharmaceutical research and development due to its potential biological activity, as well as in materials science for its unique properties. Safety data and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use.
Formula:C9H8FNO
InChI:InChI=1S/C9H8FNO/c1-12-6-8-4-9(10)3-2-7(8)5-11/h2-4H,6H2,1H3
InChI key:InChIKey=JUARJPDHIDAXOV-UHFFFAOYSA-N
SMILES:C(OC)C1=C(C#N)C=CC(F)=C1
Synonyms:- Benzonitrile, 4-fluoro-2-(methoxymethyl)-
- 4-Fluoro-2-(methoxymethyl)benzonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.