CymitQuimica logo

CAS 93406-27-0

:

3-(Diphenylmethyl)morpholine

Description:
3-(Diphenylmethyl)morpholine is an organic compound characterized by its morpholine backbone, which is a six-membered ring containing both nitrogen and oxygen atoms. The presence of the diphenylmethyl group significantly influences its chemical properties, contributing to its hydrophobic character and potential for various interactions. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its potential applications in organic synthesis, particularly as a building block in the development of pharmaceuticals and agrochemicals. The morpholine ring provides basicity due to the nitrogen atom, which can participate in hydrogen bonding and coordination with metal ions. Additionally, the diphenylmethyl substituent can enhance the compound's lipophilicity, affecting its solubility in organic solvents. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, 3-(Diphenylmethyl)morpholine is a versatile compound with significant implications in chemical research and industry.
Formula:C17H19NO
InChI:InChI=1S/C17H19NO/c1-3-7-14(8-4-1)17(15-9-5-2-6-10-15)16-13-19-12-11-18-16/h1-10,16-18H,11-13H2
InChI key:InChIKey=OVLYYUBKZWEOEQ-UHFFFAOYSA-N
SMILES:C(C1=CC=CC=C1)(C2=CC=CC=C2)C3COCCN3
Synonyms:
  • Morpholine, 3-(diphenylmethyl)-
  • 3-(Diphenylmethyl)morpholine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.