CAS 934107-83-2

1-(2-Thienylsulfonyl)-3-piperidinamine

Description:

1-(2-Thienylsulfonyl)-3-piperidinamine, identified by its CAS number 934107-83-2, is a chemical compound characterized by its unique structural features, which include a piperidine ring and a thienylsulfonyl group. The presence of the thienyl moiety, a five-membered aromatic ring containing sulfur, contributes to its potential reactivity and interaction with biological targets. The sulfonamide functional group enhances its solubility and can influence its pharmacokinetic properties. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for potential interactions with specific receptors or enzymes, which could lead to therapeutic applications. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Overall, 1-(2-Thienylsulfonyl)-3-piperidinamine represents a class of compounds that may hold promise in pharmaceutical research.

Formula: C₉H₁₄N₂O₂S₂

InChI: InChI=1S/C9H14N2O2S2/c10-8-3-1-5-11(7-8)15(12,13)9-4-2-6-14-9/h2,4,6,8H,1,3,5,7,10H2

InChI key: InChIKey=LGSIMFKVBWAZMK-UHFFFAOYSA-N

SMILES: S(=O)(=O)(N1CC(N)CCC1)C2=CC=CS2

Synonyms:

• 1-(2-Thienylsulfonyl)-3-piperidinamine
• 3-Piperidinamine, 1-(2-thienylsulfonyl)-