CAS 93413-57-1
:2-cyclohex-1-en-1-yl-2-(4-methoxyphenyl)-N,N-dimethylethanamine
Description:
2-Cyclohex-1-en-1-yl-2-(4-methoxyphenyl)-N,N-dimethylethanamine, with the CAS number 93413-57-1, is a chemical compound characterized by its complex structure, which includes a cyclohexene ring and a methoxy-substituted phenyl group. This compound features a dimethylamino group, contributing to its potential as a psychoactive substance. The presence of the cyclohexene moiety suggests that it may exhibit unique reactivity and stability compared to saturated cyclic amines. Its methoxy group can influence solubility and polarity, affecting its interactions in biological systems. The compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. Additionally, the presence of multiple functional groups indicates potential for various chemical reactions, making it a candidate for further research in synthetic organic chemistry. However, specific biological activity, toxicity, and pharmacokinetics would require detailed experimental studies to fully understand its properties and potential applications.
Formula:C17H25NO
InChI:InChI=1/C17H25NO/c1-18(2)13-17(14-7-5-4-6-8-14)15-9-11-16(19-3)12-10-15/h7,9-12,17H,4-6,8,13H2,1-3H3
SMILES:CN(C)CC(C1=CCCCC1)c1ccc(cc1)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Dehydro Venlafaxine
CAS:Controlled ProductFormula:C17H25NOColor and Shape:NeatMolecular weight:259.39
