CAS 934172-41-5

5-Methyl-3-isoxazoleacetic acid hydrazide

Description:

5-Methyl-3-isoxazoleacetic acid hydrazide is a chemical compound characterized by its unique isoxazole ring structure, which contributes to its biological activity. This compound features a hydrazide functional group, which is known for its reactivity and potential applications in medicinal chemistry. The presence of the methyl group at the 5-position of the isoxazole ring influences its solubility and interaction with biological targets. Typically, compounds like this may exhibit properties such as anti-inflammatory or neuroprotective effects, making them of interest in pharmaceutical research. The molecular structure allows for various interactions with enzymes and receptors, potentially leading to therapeutic applications. Additionally, the compound's stability, reactivity, and solubility in different solvents can vary, impacting its usability in laboratory and industrial settings. As with many hydrazides, care must be taken regarding their handling and storage due to potential reactivity. Overall, 5-Methyl-3-isoxazoleacetic acid hydrazide represents a class of compounds that are valuable in the exploration of new therapeutic agents.

Formula: C₆H₉N₃O₂

InChI: InChI=1S/C6H9N3O2/c1-4-2-5(9-11-4)3-6(10)8-7/h2H,3,7H2,1H3,(H,8,10)

InChI key: InChIKey=ZLRRLPXAEDGQKL-UHFFFAOYSA-N

SMILES: C(C(NN)=O)C=1C=C(C)ON1

Synonyms:

• 3-Isoxazoleacetic acid, 5-methyl-, hydrazide
• 5-Methyl-3-isoxazoleacetic acid hydrazide
• 2-(5-Methylisoxazol-3-yl)acetohydrazide