CymitQuimica logo

CAS 934175-23-2

:

(2S)-2-Hydroxypropanoic acid hydrazide

Description:
(2S)-2-Hydroxypropanoic acid hydrazide, identified by its CAS number 934175-23-2, is a chemical compound characterized by the presence of a hydrazide functional group attached to a hydroxypropanoic acid backbone. This compound typically exhibits properties associated with both hydrazides and amino acids, including potential solubility in polar solvents due to the presence of hydroxyl and amine functionalities. The stereochemistry indicated by the (2S) designation suggests that it has a specific three-dimensional arrangement, which can influence its biological activity and reactivity. Hydrazides are known for their ability to form stable complexes with various metal ions and can participate in condensation reactions, making them valuable in synthetic organic chemistry. Additionally, compounds like this may exhibit biological activity, potentially serving as intermediates in pharmaceutical synthesis or as active pharmaceutical ingredients. Overall, (2S)-2-Hydroxypropanoic acid hydrazide is a versatile compound with applications in both research and industry, particularly in the fields of medicinal chemistry and biochemistry.
Formula:C3H8N2O2
InChI:InChI=1S/C3H8N2O2/c1-2(6)3(7)5-4/h2,6H,4H2,1H3,(H,5,7)/t2-/m0/s1
InChI key:InChIKey=QCICYPQPGJJZGW-REOHCLBHSA-N
SMILES:C([C@H](C)O)(NN)=O
Synonyms:
  • (2S)-2-Hydroxypropanehydrazide
  • Propanoic acid, 2-hydroxy-, hydrazide, (2S)-
  • (2S)-2-Hydroxypropanoic acid hydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.