CAS 934188-81-5

5-(2,4-Difluorophenyl)-3-isoxazolemethanol

Description:

5-(2,4-Difluorophenyl)-3-isoxazolemethanol is a chemical compound characterized by its unique structural features, which include an isoxazole ring and a difluorophenyl group. The presence of the isoxazole moiety contributes to its potential biological activity, as this heterocyclic structure is often found in various pharmaceuticals and agrochemicals. The difluorophenyl substituent enhances the compound's lipophilicity and may influence its interaction with biological targets. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of compounds with specific pharmacological properties. Additionally, the presence of hydroxyl (-OH) functionality in the isoxazolemethanol portion may impart hydrogen-bonding capabilities, which can be crucial for its reactivity and interaction with other molecules. Overall, 5-(2,4-Difluorophenyl)-3-isoxazolemethanol represents a compound of interest for further research in various chemical and biological fields.

Formula: C₁₀H₇F₂NO₂

InChI: InChI=1S/C10H7F2NO2/c11-6-1-2-8(9(12)3-6)10-4-7(5-14)13-15-10/h1-4,14H,5H2

InChI key: InChIKey=ULPAADJUUMKRRS-UHFFFAOYSA-N

SMILES: FC1=C(C2=CC(CO)=NO2)C=CC(F)=C1

Synonyms:

• [5-(2,4-Difluorophenyl)-1,2-oxazol-3-yl]methanol
• [5-(2,4-Difluorophenyl)-3-isoxazolyl]methanol
• 3-Isoxazolemethanol, 5-(2,4-difluorophenyl)-
• 5-(2,4-Difluorophenyl)-3-isoxazolemethanol

[5-(2,4-difluorophenyl)isoxazol-3-yl]methanol

CAS: 934188-81-5

Formula: C₁₀H₇F₂NO₂

Purity: 95.0%

Molecular weight: 211.168

Ref: 10-F495231

[5-(2,4-Difluorophenyl)-1,2-oxazol-3-yl]methanol

CAS: 934188-81-5

Versatile small molecule scaffold

Formula: C₁₀H₇F₂NO₂

Purity: Min. 95%

Molecular weight: 211.16 g/mol

Ref: 3D-JMB18881