CAS 934236-31-4
:methyl 5-[(methylsulfamoyl)methyl]-1H-indole-3-carboxylate
Description:
Methyl 5-[(methylsulfamoyl)methyl]-1H-indole-3-carboxylate is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a methylsulfamoyl group, which contributes to its potential biological activity, particularly in medicinal chemistry. The presence of the carboxylate group indicates that it can participate in various chemical reactions, including esterification and amidation. The methyl group attached to the sulfamoyl moiety enhances its solubility and reactivity. This compound may exhibit properties such as antimicrobial or anti-inflammatory activity, making it of interest in pharmaceutical research. Its specific interactions and mechanisms of action would depend on its molecular structure and the functional groups present. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Overall, methyl 5-[(methylsulfamoyl)methyl]-1H-indole-3-carboxylate represents a unique structure that may have significant implications in drug development and chemical synthesis.
Formula:C12H14N2O4S
InChI:InChI=1/C12H14N2O4S/c1-13-19(16,17)7-8-3-4-11-9(5-8)10(6-14-11)12(15)18-2/h3-6,13-14H,7H2,1-2H3
SMILES:CNS(=O)(=O)Cc1ccc2c(c1)c(c[nH]2)C(=O)OC
Synonyms:- Methyl 5-[(methylsulfamoyl)methyl]-1H-indole-3-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-Methylsulfamoylmethyl-1H-indole-3-carboxylic acid methyl ester
CAS:Formula:C12H14N2O4SMolecular weight:282.3156

