CAS 934236-33-6
:2,5-dibromo-4-(chloromethyl)-1,3-thiazole
Description:
2,5-Dibromo-4-(chloromethyl)-1,3-thiazole is a heterocyclic organic compound characterized by its thiazole ring, which contains both sulfur and nitrogen atoms. The presence of bromine and chloromethyl groups contributes to its reactivity and potential applications in various chemical reactions. This compound typically exhibits moderate to high stability under standard conditions but may be sensitive to light and moisture. Its structure suggests potential biological activity, making it of interest in medicinal chemistry and agrochemical research. The thiazole moiety is known for its role in various pharmacologically active compounds, and the halogen substituents can enhance its lipophilicity and biological interactions. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 2,5-dibromo-4-(chloromethyl)-1,3-thiazole is a compound with significant potential for further study in synthetic and applied chemistry contexts.
Formula:C4H2Br2ClNS
InChI:InChI=1/C4H2Br2ClNS/c5-3-2(1-7)8-4(6)9-3/h1H2
SMILES:C(c1c(Br)sc(Br)n1)Cl
Synonyms:- Thiazole, 2,5-dibromo-4-(chloromethyl)-
- 2,5-Dibromo-4-(chloromethyl)-1,3-thiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4-(Chloromethyl)-2,5-dibromo-1,3-thiazole
CAS:4-(Chloromethyl)-2,5-dibromo-1,3-thiazole
Molecular weight:291.39g/mol


