CAS 934236-38-1
:2-Thiazolesulfonyl fluoride
Description:
2-Thiazolesulfonyl fluoride is a chemical compound characterized by the presence of a thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features a sulfonyl fluoride functional group, which contributes to its reactivity and potential applications in various chemical processes. Typically, thiazoles are known for their biological activity, and the sulfonyl fluoride moiety can act as a potent electrophile, making this compound useful in the synthesis of pharmaceuticals and agrochemicals. The presence of the sulfonyl fluoride group also suggests that it may participate in nucleophilic substitution reactions, where it can react with nucleophiles to form sulfonamides or other derivatives. Additionally, 2-thiazolesulfonyl fluoride may exhibit properties such as solubility in polar organic solvents and stability under certain conditions, although specific stability and reactivity can vary based on environmental factors. Overall, this compound is of interest in synthetic organic chemistry and medicinal chemistry due to its unique structural features and reactivity.
Formula:C3H2FNO2S2
InChI:InChI=1S/C3H2FNO2S2/c4-9(6,7)3-5-1-2-8-3/h1-2H
InChI key:InChIKey=ZTEVDEORQHXCNV-UHFFFAOYSA-N
SMILES:S(F)(=O)(=O)C1=NC=CS1
Synonyms:- 2-Thiazolesulfonyl fluoride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.