CAS 934236-41-6

Methyl 2-chlorooxazole-5-carboxylate

Description:

Methyl 2-chlorooxazole-5-carboxylate is a chemical compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. This compound features a carboxylate group, which contributes to its reactivity and potential applications in organic synthesis. The presence of a chlorine atom at the 2-position of the oxazole ring enhances its electrophilic properties, making it useful in various chemical reactions, such as nucleophilic substitutions. Methyl 2-chlorooxazole-5-carboxylate is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents, which facilitates its use in chemical reactions and formulations. This compound may be utilized in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals due to its versatile reactivity. As with many chemical substances, proper handling and safety precautions are essential, as it may pose health risks if ingested or inhaled.

Formula: C₅H₄ClNO₃

InChI: InChI=1/C5H4ClNO3/c1-9-4(8)3-2-7-5(6)10-3/h2H,1H3

SMILES: COC(=O)c1cnc(Cl)o1

Synonyms:

• 2-Chloro-5-oxazolecarboxylicacid methyl ester
• Methyl 2-Chloro-1,3-Oxazole-4-Carboxylate

Methyl 2-chlorooxazole-5-carboxylate

CAS: 934236-41-6

Formula: C₅H₄ClNO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 161.5432

Ref: IN-DA0063KQ

Methyl 2-chloro-1,3-oxazole-5-carboxylate

CAS: 934236-41-6

Methyl 2-chloro-1,3-oxazole-5-carboxylate

Formula: C₅H₄ClNO₃

Purity: 97%

Color and Shape: Powder

Molecular weight: 161.54g/mol

Ref: 54-OR15584

Methyl 2-chlorooxazole-5-carboxylate

CAS: 934236-41-6

Formula: C₅H₄ClNO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 161.54

Ref: 10-F037243