CAS 93430-30-9
:2-(1-Hydroxyheptyl)cyclopentanone
Description:
2-(1-Hydroxyheptyl)cyclopentanone is an organic compound characterized by its cyclopentanone structure, which features a five-membered carbon ring with a ketone functional group. The presence of a hydroxyheptyl substituent indicates that there is a hydroxyl group (-OH) attached to a heptyl chain, contributing to the compound's hydrophilicity and potential for hydrogen bonding. This compound is likely to exhibit moderate volatility and solubility in organic solvents, while its hydroxyl group may enhance solubility in polar solvents. The molecular structure suggests that it may have applications in the synthesis of other organic compounds or as an intermediate in chemical reactions. Additionally, the presence of both hydrophobic (the cyclopentanone and heptyl chain) and hydrophilic (the hydroxyl group) components may influence its behavior in biological systems, potentially affecting its reactivity and interactions with other molecules. As with many organic compounds, safety data and handling precautions should be considered, particularly regarding its potential toxicity and environmental impact.
Formula:C12H22O2
InChI:InChI=1S/C12H22O2/c1-2-3-4-5-8-11(13)10-7-6-9-12(10)14/h10-11,13H,2-9H2,1H3
InChI key:InChIKey=VZAPPURGJHNQTF-UHFFFAOYSA-N
SMILES:C(CCCCCC)(O)C1C(=O)CCC1
Synonyms:- 2-(1-Hydroxyheptyl)cyclopentanone
- 2-(1-Hydroxyheptyl)cyclopentan-1-one
- Cyclopentanone, 2-(1-hydroxyheptyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(1-Hydroxyheptyl)cyclopentanone
CAS:Controlled ProductFormula:C12H22O2Color and Shape:NeatMolecular weight:198.302
