CAS 934333-16-1
:1,7-Dimethyl-1H-imidazo[4,5-g]quinoxalin-2-amine
Description:
1,7-Dimethyl-1H-imidazo[4,5-g]quinoxalin-2-amine is a heterocyclic organic compound characterized by its complex bicyclic structure, which incorporates both imidazole and quinoxaline moieties. This compound features two methyl groups at the 1 and 7 positions of the imidazole ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. The presence of the amino group at the 2 position enhances its potential for hydrogen bonding and reactivity, making it of interest in medicinal chemistry and drug development. This compound may also display biological activity, particularly in the context of targeting specific receptors or enzymes. Its molecular structure allows for potential interactions with various biological systems, which can be explored in pharmacological studies. As with many heterocycles, it may also exhibit fluorescence properties, making it useful in various analytical applications. Overall, 1,7-Dimethyl-1H-imidazo[4,5-g]quinoxalin-2-amine represents a versatile scaffold for further chemical modifications and investigations.
Formula:C11H11N5
InChI:InChI=1S/C11H11N5/c1-6-5-13-7-3-9-10(4-8(7)14-6)16(2)11(12)15-9/h3-5H,1-2H3,(H2,12,15)
InChI key:InChIKey=VDYWCSWBQPTHDB-UHFFFAOYSA-N
SMILES:CN1C=2C(=CC=3C(C2)=NC(C)=CN3)N=C1N
Synonyms:- 1,7-Dimethyl-1H-imidazo[4,5-g]quinoxalin-2-amine
- 1H-Imidazo[4,5-g]quinoxalin-2-amine, 1,7-dimethyl-
- 3,6-Dimethylimidazo[4,5-g]quinoxalin-2-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,7-Dimethyl-1H-imidazo[4,5-g]quinoxalin-2-amine
CAS:Controlled ProductFormula:C11H11N5Color and Shape:NeatMolecular weight:213.238
