CAS 934333-16-1

1,7-Dimethyl-1H-imidazo[4,5-g]quinoxalin-2-amine

Description:

1,7-Dimethyl-1H-imidazo[4,5-g]quinoxalin-2-amine is a heterocyclic organic compound characterized by its complex bicyclic structure, which incorporates both imidazole and quinoxaline moieties. This compound features two methyl groups at the 1 and 7 positions of the imidazole ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. The presence of the amino group at the 2 position enhances its potential for hydrogen bonding and reactivity, making it of interest in medicinal chemistry and drug development. This compound may also display biological activity, particularly in the context of targeting specific receptors or enzymes. Its molecular structure allows for potential interactions with various biological systems, which can be explored in pharmacological studies. As with many heterocycles, it may also exhibit fluorescence properties, making it useful in various analytical applications. Overall, 1,7-Dimethyl-1H-imidazo[4,5-g]quinoxalin-2-amine represents a versatile scaffold for further chemical modifications and investigations.

Formula: C₁₁H₁₁N₅

InChI: InChI=1S/C11H11N5/c1-6-5-13-7-3-9-10(4-8(7)14-6)16(2)11(12)15-9/h3-5H,1-2H3,(H2,12,15)

InChI key: InChIKey=VDYWCSWBQPTHDB-UHFFFAOYSA-N

SMILES: CN1C=2C(=CC=3C(C2)=NC(C)=CN3)N=C1N

Synonyms:

• 1,7-Dimethyl-1H-imidazo[4,5-g]quinoxalin-2-amine
• 1H-Imidazo[4,5-g]quinoxalin-2-amine, 1,7-dimethyl-
• 3,6-Dimethylimidazo[4,5-g]quinoxalin-2-amine

1,7-Dimethyl-1H-imidazo[4,5-g]quinoxalin-2-amine

Controlled Product

CAS: 934333-16-1

Formula: C₁₁H₁₁N₅

Color and Shape: Neat

Molecular weight: 213.238

Ref: TR-D474020