CAS 934365-38-5

6-Ethenyl-2-(methylthio)-4(3H)-pyrimidinone

Description:

6-Ethenyl-2-(methylthio)-4(3H)-pyrimidinone, identified by its CAS number 934365-38-5, is a heterocyclic organic compound featuring a pyrimidinone core structure. This compound is characterized by the presence of an ethenyl group at the 6-position and a methylthio group at the 2-position of the pyrimidinone ring. The molecular structure contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound may exhibit properties such as solubility in organic solvents, and its reactivity can be influenced by the functional groups present. Pyrimidinones are known for their role in various biological processes and can serve as precursors or intermediates in the synthesis of pharmaceuticals. The specific characteristics, such as melting point, boiling point, and spectral data, would typically be determined through experimental methods and can vary based on purity and environmental conditions. Overall, 6-Ethenyl-2-(methylthio)-4(3H)-pyrimidinone represents a unique structure that may have applications in drug development and other chemical research fields.

Formula: C₇H₈N₂OS

InChI: InChI=1S/C7H8N2OS/c1-3-5-4-6(10)9-7(8-5)11-2/h3-4H,1H2,2H3,(H,8,9,10)

InChI key: InChIKey=SVJNZLLNJCPMJJ-UHFFFAOYSA-N

SMILES: C(=C)C=1NC(SC)=NC(=O)C1

Synonyms:

• 4(3H)-Pyrimidinone, 6-ethenyl-2-(methylthio)-
• 6-Ethenyl-2-(methylthio)-4(3H)-pyrimidinone