CAS 934388-23-5

(4-bromopyrrolo[2,3-b]pyridin-1-yl)-trimethyl-silane

Description:

(4-bromopyrrolo[2,3-b]pyridin-1-yl)-trimethyl-silane is a chemical compound characterized by its unique structure, which includes a pyrrolo[2,3-b]pyridine core substituted with a bromine atom and a trimethylsilyl group. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical transformations, including nucleophilic substitutions and cross-coupling reactions. The trimethylsilyl group enhances the compound's stability and solubility in organic solvents, facilitating its use in synthetic applications. This compound may exhibit interesting biological activities due to its heterocyclic structure, which is often associated with pharmacological properties. Additionally, its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. As with many organosilicon compounds, it may also play a role in materials science, particularly in the development of silane-based coatings or polymers. Overall, (4-bromopyrrolo[2,3-b]pyridin-1-yl)-trimethyl-silane represents a versatile building block in organic synthesis and drug development.

Formula: C₁₀H₁₃BrN₂Si

InChI: InChI=1/C10H13BrN2Si/c1-14(2,3)13-7-5-8-9(11)4-6-12-10(8)13/h4-7H,1-3H3

SMILES: C[Si](C)(C)n1ccc2c(ccnc12)Br

Synonyms:

• 4-Brom-1-(trimethylsilyl)-1H-pyrrolo[2,3-b]pyridin
• 4-bromo-1-(trimethylsilyl)-1H-pyrrolo[2,3-b]pyridine4-bromo-1-[tris(propan-2-yl)silyl]-1H-pyrrolo[2,3-b]pyridine