CAS 934464-79-6
:(10S,12S,13R)-4-Chloro-6,7,10,11,12,13-hexahydro-5,10,12,13,15,16-hexahydroxy-8-methoxy-2-methyl-3-propyl-2H-[1]benzopyrano[2′,3′:6,7]naphth[2,1-g]isoquinoline-1,14-dione
Description:
The chemical substance with the name "(10S,12S,13R)-4-Chloro-6,7,10,11,12,13-hexahydro-5,10,12,13,15,16-hexahydroxy-8-methoxy-2-methyl-3-propyl-2H-[1]benzopyrano[2′,3′:6,7]naphth[2,1-g]isoquinoline-1,14-dione" and CAS number "934464-79-6" is a complex organic compound characterized by its intricate polycyclic structure, which includes multiple hydroxy and methoxy functional groups. The presence of chlorine and various hydroxy groups suggests potential biological activity, possibly indicating its use in medicinal chemistry or as a pharmacological agent. The stereochemistry, denoted by the specific configuration at several chiral centers, may influence its interaction with biological targets, affecting its efficacy and safety profile. This compound's structural features may also contribute to its solubility, stability, and reactivity, making it of interest for further research in fields such as drug development or organic synthesis. Overall, its unique characteristics warrant detailed investigation to fully understand its potential applications and mechanisms of action.
Formula:C29H28ClNO10
InChI:InChI=1S/C29H28ClNO10/c1-4-5-11-20(30)16-17(29(39)31(11)2)23(36)14-9(21(16)34)6-7-10-15(14)24(37)19-25(38)18-22(35)12(32)8-13(33)27(18)41-28(19)26(10)40-3/h12-13,22,32-37H,4-8H2,1-3H3/t12-,13-,22-/m0/s1
InChI key:InChIKey=NEZGGHIIKFHZCZ-MZFXBISCSA-N
SMILES:OC1=C2C=3C(=C(O)C4=C(C3O)C(=O)N(C)C(CCC)=C4Cl)CCC2=C(OC)C5=C1C(=O)C6=C(O5)[C@@H](O)C[C@H](O)[C@@H]6O
Synonyms:- (+)-Kibdelone C
- (10S,12S,13R)-4-Chloro-6,7,10,11,12,13-hexahydro-5,10,12,13,15,16-hexahydroxy-8-methoxy-2-methyl-3-propyl-2H-[1]benzopyrano[2′,3′:6,7]naphth[2,1-g]isoquinoline-1,14-dione
- Kibdelone C
- 2H-[1]Benzopyrano[2′,3′:6,7]naphth[2,1-g]isoquinoline-1,14-dione, 4-chloro-6,7,10,11,12,13-hexahydro-5,10,12,13,15,16-hexahydroxy-8-methoxy-2-methyl-3-propyl-, (10S,12S,13R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Kibdelone C
CAS:Kibdelone C: natural polyketide with selective cytotoxicity against human tumors, disrupts actin cytoskeleton, low nanomolar efficacy.Formula:C29H28ClNO10Color and Shape:SolidMolecular weight:585.99
