CAS 934524-28-4
:4-Amino-N-(2,2,2-trifluoroethyl)benzamide
Description:
4-Amino-N-(2,2,2-trifluoroethyl)benzamide is an organic compound characterized by the presence of an amino group and a benzamide structure, which contributes to its potential as a pharmaceutical intermediate or in other chemical applications. The trifluoroethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. This compound typically exhibits a solid state at room temperature and is soluble in polar organic solvents. Its molecular structure suggests that it may participate in hydrogen bonding due to the amino and carbonyl groups, which can affect its reactivity and interactions with biological targets. The presence of fluorine atoms can also impart unique electronic properties, potentially affecting its pharmacokinetics and pharmacodynamics. Safety data should be consulted for handling and exposure guidelines, as fluorinated compounds can exhibit different toxicological profiles compared to their non-fluorinated counterparts. Overall, 4-Amino-N-(2,2,2-trifluoroethyl)benzamide is a compound of interest in various fields, particularly in the development of new therapeutic agents.
Formula:C9H9F3N2O
InChI:InChI=1S/C9H9F3N2O/c10-9(11,12)5-14-8(15)6-1-3-7(13)4-2-6/h1-4H,5,13H2,(H,14,15)
InChI key:InChIKey=JJSRGTLQYXZSQR-UHFFFAOYSA-N
SMILES:C(NCC(F)(F)F)(=O)C1=CC=C(N)C=C1
Synonyms:- 4-Amino-N-(2,2,2-trifluoroethyl)benzamide
- Benzamide, 4-amino-N-(2,2,2-trifluoroethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.