CAS 93455-50-6
:D-Glucitol, reaction products with palmitic acid
Description:
D-Glucitol, also known as sorbitol, is a sugar alcohol derived from glucose. The reaction products of D-Glucitol with palmitic acid involve the formation of esters, which are typically characterized by their fatty acid and alcohol components. These esters can exhibit properties such as improved solubility, emulsification, and stability, making them useful in various applications, including food, cosmetics, and pharmaceuticals. The presence of palmitic acid, a saturated fatty acid, contributes to the hydrophobic characteristics of the resulting compounds, which can enhance their performance in formulations. Additionally, the reaction products may possess unique physical and chemical properties, such as varying melting points, viscosity, and reactivity, depending on the specific conditions of the reaction and the ratio of reactants used. Overall, the combination of D-Glucitol and palmitic acid results in versatile compounds that can be tailored for specific industrial applications.
Formula:C16H32O2·C6H14O6
InChI:InChI=1S/C16H32O2.C6H14O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;7-1-3(9)5(11)6(12)4(10)2-8/h2-15H2,1H3,(H,17,18);3-12H,1-2H2/t;3-,4+,5-,6-/m.1/s1
InChI key:InChIKey=NSZWQJSPGLSSNU-VCDGYCQFSA-N
SMILES:C(CCCCCCCCCC)CCCCC(O)=O.[C@H]([C@@H]([C@@H](CO)O)O)([C@H](CO)O)O
Synonyms:- D-Glucitol, reaction products with palmitic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
