CAS 934558-37-9
:2-(2-Methoxyphenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane
Description:
2-(2-Methoxyphenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane is an organoboron compound characterized by its unique dioxaborinane structure, which features a boron atom bonded to two oxygen atoms and a carbon framework. This compound typically exhibits a stable, cyclic structure that contributes to its reactivity and potential applications in organic synthesis, particularly in the formation of carbon-boron bonds. The presence of the methoxyphenyl group enhances its solubility in organic solvents and may influence its electronic properties, making it useful in various chemical reactions, including cross-coupling reactions. Additionally, the trimethyl groups provide steric hindrance, which can affect the compound's reactivity and selectivity in chemical transformations. Overall, this compound is of interest in the fields of medicinal chemistry and materials science due to its potential utility in the development of new pharmaceuticals and functional materials.
Formula:C13H19BO3
InChI:InChI=1S/C13H19BO3/c1-10-9-13(2,3)17-14(16-10)11-7-5-6-8-12(11)15-4/h5-8,10H,9H2,1-4H3
InChI key:InChIKey=ALOLSCLBNZSAMC-UHFFFAOYSA-N
SMILES:O(C)C1=C(B2OC(C)(C)CC(C)O2)C=CC=C1
Synonyms:- 1,3,2-Dioxaborinane, 2-(2-methoxyphenyl)-4,4,6-trimethyl-
- 2-(2-Methoxyphenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(2-Methoxyphenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane
CAS:2-(2-Methoxyphenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane
Molecular weight:234.10g/mol
