CymitQuimica logo

CAS 934568-22-6

:

5-Bromo-3-iodo-1-methyl-1H-pyrrolo[2,3-b]pyridine

Description:
5-Bromo-3-iodo-1-methyl-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its complex bicyclic structure, which includes a pyridine and a pyrrole moiety. The presence of bromine and iodine substituents on the aromatic ring contributes to its reactivity and potential applications in medicinal chemistry and material science. This compound typically exhibits properties such as moderate solubility in organic solvents and stability under standard laboratory conditions. Its molecular structure allows for various chemical modifications, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. The presence of halogens can enhance its biological activity, potentially influencing its interactions with biological targets. Additionally, the compound may exhibit unique electronic properties due to the conjugated system formed by the fused rings, which can be exploited in electronic applications. Overall, 5-Bromo-3-iodo-1-methyl-1H-pyrrolo[2,3-b]pyridine is of interest for its synthetic versatility and potential utility in various chemical and biological contexts.
Formula:C8H6BrIN2
InChI:InChI=1S/C8H6BrIN2/c1-12-4-7(10)6-2-5(9)3-11-8(6)12/h2-4H,1H3
InChI key:InChIKey=JPUPPVFWAFJTHH-UHFFFAOYSA-N
SMILES:IC=1C=2C(N(C)C1)=NC=C(Br)C2
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridine, 5-bromo-3-iodo-1-methyl-
  • 5-Bromo-3-iodo-1-methyl-1H-pyrrolo[2,3-b]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.