
CAS 93468-89-4
:Methyl 1,4-dihydro-2,6-dimethyl-5-nitro-4-[2-(trifluoromethyl)phenyl]-3-pyridinecarboxylate
Description:
Methyl 1,4-dihydro-2,6-dimethyl-5-nitro-4-[2-(trifluoromethyl)phenyl]-3-pyridinecarboxylate, with CAS number 93468-89-4, is a chemical compound characterized by its complex structure, which includes a pyridine ring and various functional groups such as a nitro group and a trifluoromethyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility in organic solvents. The presence of the nitro group suggests it may have applications in pharmaceuticals or agrochemicals, as nitro compounds often exhibit biological activity. The trifluoromethyl group enhances lipophilicity, potentially influencing the compound's interaction with biological membranes. Additionally, the methyl ester functional group indicates that it can undergo hydrolysis to yield the corresponding carboxylic acid. Overall, this compound's unique structural features may lead to interesting chemical behavior and applications in various fields, including medicinal chemistry and materials science.
Formula:C16H15F3N2O4
InChI:InChI=1S/C16H15F3N2O4/c1-8-12(15(22)25-3)13(14(21(23)24)9(2)20-8)10-6-4-5-7-11(10)16(17,18)19/h4-7,13,20H,1-3H3
InChI key:InChIKey=ZFLWDHHVRRZMEI-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C(C(N(=O)=O)=C(C)NC1C)C2=C(C(F)(F)F)C=CC=C2
Synonyms:- BAY-k 8644
- Methyl 1,4-dihydro-2,6-dimethyl-5-nitro-4-[2-(trifluoromethyl)phenyl]-3-pyridinecarboxylate
- 3-Pyridinecarboxylic acid, 1,4-dihydro-2,6-dimethyl-5-nitro-4-[2-(trifluoromethyl)phenyl]-, methyl ester
- BK 8644
- SQ 28873
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.