CymitQuimica logo

CAS 93469-29-5

:

N-(3-aminophenyl)butanamide

Description:
N-(3-aminophenyl)butanamide, with the CAS number 93469-29-5, is an organic compound characterized by its amide functional group and an aromatic amine structure. It features a butanamide backbone, which consists of a four-carbon chain terminating in a carbonyl group (C=O) linked to an amine (NH2) group on a phenyl ring. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amine and carbonyl groups, which can engage in hydrogen bonding. The presence of the amino group suggests potential for biological activity, making it of interest in medicinal chemistry and drug development. Additionally, the compound may participate in various chemical reactions, such as acylation or amidation, and could serve as a precursor for synthesizing more complex molecules. Its specific properties, such as melting point, boiling point, and reactivity, would depend on the molecular interactions and the environment in which it is studied.
Formula:C10H14N2O
InChI:InChI=1/C10H14N2O/c1-2-4-10(13)12-9-6-3-5-8(11)7-9/h3,5-7H,2,4,11H2,1H3,(H,12,13)
InChI key:DRXFARCOYOPZDW-UHFFFAOYSA-N
SMILES:CCCC(=Nc1cccc(c1)N)O
Synonyms:
  • butanamide, N-(3-aminophenyl)-
Found 4 products.