CAS 934690-32-1
:6-fluoro-7-nitroquinoxalin-2(1H)-one
Description:
6-Fluoro-7-nitroquinoxalin-2(1H)-one is a synthetic organic compound belonging to the quinoxaline family, characterized by its unique bicyclic structure. This compound features a fluorine atom at the 6-position and a nitro group at the 7-position of the quinoxaline ring, which contributes to its chemical reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the nitro group often imparts significant electron-withdrawing properties, influencing the compound's reactivity and interactions with biological targets. This compound is of interest in medicinal chemistry, particularly for its potential applications in neuroscience and pharmacology, as quinoxaline derivatives have been studied for their roles as modulators of neurotransmitter receptors. Additionally, its structural features may allow for further derivatization, making it a valuable scaffold for the development of new therapeutic agents. Safety and handling precautions should be observed due to the presence of the nitro group, which can pose hazards in certain conditions.
Formula:C8H4FN3O3
InChI:InChI=1/C8H4FN3O3/c9-4-1-5-6(2-7(4)12(14)15)11-8(13)3-10-5/h1-3H,(H,11,13)
SMILES:c1c(c(cc2c1ncc(n2)O)N(=O)=O)F
Synonyms:- 2(1H)-quinoxalinone, 6-fluoro-7-nitro-
- 6-Fluoro-7-nitroquinoxalin-2(1H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
