CAS 934691-48-2

[1,1'-biphenyl]-2-carboxaldehyde, 4-methoxy-

Description:

[1,1'-Biphenyl]-2-carboxaldehyde, 4-methoxy- is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxaldehyde functional group (-CHO) at the 2-position and a methoxy group (-OCH3) at the 4-position on one of the phenyl rings contributes to its reactivity and solubility properties. This compound typically exhibits moderate polarity due to the functional groups, making it soluble in organic solvents while having limited solubility in water. It may participate in various chemical reactions, including nucleophilic additions and condensation reactions, due to the electrophilic nature of the aldehyde group. Additionally, the methoxy group can influence the electronic properties of the molecule, potentially affecting its reactivity and interaction with other chemical species. Overall, [1,1'-biphenyl]-2-carboxaldehyde, 4-methoxy- is of interest in organic synthesis and may have applications in pharmaceuticals or materials science.

Formula: C₁₄H₁₂O₂

InChI: InChI=1/C14H12O2/c1-16-13-7-8-14(12(9-13)10-15)11-5-3-2-4-6-11/h2-10H,1H3

SMILES: COc1ccc(c2ccccc2)c(c1)C=O

Synonyms:

• 4-Methoxybiphenyl-2-carbaldehyde

5-Methoxy-2-phenylbenzonitrile

CAS: 934691-48-2

Formula: C₁₄H₁₂O₂

Purity: 95%

Molecular weight: 212.2439

Ref: IN-DA00IHN0