CAS 934758-27-7

2-Amino-6-bromo-3-pyridinol

Description:

2-Amino-6-bromo-3-pyridinol is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features an amino group (-NH2) and a bromo substituent (-Br) at specific positions on the pyridine ring, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the amino group makes it a potential candidate for further derivatization, while the bromine atom can serve as a leaving group in nucleophilic substitution reactions. This compound is typically used in research and development, particularly in the synthesis of pharmaceuticals and agrochemicals. Its properties include solubility in polar solvents, and it may exhibit biological activity due to the functional groups present. As with many nitrogen-containing heterocycles, it may also participate in hydrogen bonding, influencing its interactions in biological systems. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₅H₅BrN₂O

InChI: InChI=1S/C5H5BrN2O/c6-4-2-1-3(9)5(7)8-4/h1-2,9H,(H2,7,8)

SMILES: c1cc(Br)nc(c1O)N

Synonyms:

• 2-Amino-6-bromo-3-hydroxypyridine

2-Amino-6-bromopyridin-3-ol

CAS: 934758-27-7

Formula: C₅H₅BrN₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 189.0100

Ref: IN-DA006FHB

2-Amino-6-bromopyridin-3-ol

CAS: 934758-27-7

2-Amino-6-bromopyridin-3-ol

Purity: 96%

Molecular weight: 189.01g/mol

Ref: 54-OR79585

2-Amino-6-bromopyridin-3-ol

CAS: 934758-27-7

Formula: C₅H₅BrN₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 189.012

Ref: 10-F222257